C12H23N3S — CID 114556165
4-methylsulfanyl-N-[(2-propylpyrazol-3-yl)methyl]butan-1-amine (PubChem CID 114556165) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[(2-propylpyrazol-3-yl)methyl]butan-1-amine.
| Compound Name | 4-methylsulfanyl-N-[(2-propylpyrazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 114556165 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-methylsulfanyl-N-[(2-propylpyrazol-3-yl)methyl]butan-1-amine |
| SMILES | CCCn1nccc1CNCCCCSC |
| InChI | InChI=1S/C12H23N3S/c1-3-9-15-12(6-8-14-15)11-13-7-4-5-10-16-2/h6,8,13H,3-5,7,9-11H2,1-2H3 |
| InChIKey | UMQDJNUDFYAOIT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|