About dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide)
dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) (PubChem CID 11455628) has the molecular formula C26H24Cl2MnN4O2
and a molecular weight of 550.35 g/mol. Its IUPAC name is dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide).
Molecular Properties
| Compound Name | dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) |
| PubChem CID | 11455628 |
| Molecular Formula | C26H24Cl2MnN4O2 |
| Molecular Weight | 550.35 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) |
| SMILES | Cc1ccc(NC(=O)c2ccccn2)cc1.Cc1ccc(NC(=O)c2ccccn2)cc1.Cl[Mn]Cl |
| InChI | InChI=1S/2C13H12N2O.2ClH.Mn/c2*1-10-5-7-11(8-6-10)15-13(16)12-4-2-3-9-14-12;;;/h2*2-9H,1H3,(H,15,16);2*1H;/q;;;;+2/p-2 |
| InChIKey | KVXQKMMGOPZYGI-UHFFFAOYSA-L |
| XLogP | 6.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.35 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide)?
The IUPAC name of dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) (CID 11455628) is dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide).
What is the SMILES notation for dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide)?
The canonical SMILES for dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) is Cc1ccc(NC(=O)c2ccccn2)cc1.Cc1ccc(NC(=O)c2ccccn2)cc1.Cl[Mn]Cl.
What is the InChIKey of dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide)?
The InChIKey is KVXQKMMGOPZYGI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H12N2O.2ClH.Mn/c2*1-10-5-7-11(8-6-10)15-13(16)12-4-2-3-9-14-12;;;/h2*2-9H,1H3,(H,15,16);2*1H;/q;;;;+2/p-2.
What are the key properties of dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide)?
dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) has a molecular weight of 550.35 g/mol, XLogP of 6.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromanganese;bis(N-(4-methylphenyl)pyridine-2-carboxamide) is sourced from PubChem (CID 11455628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).