About N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine
N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine (PubChem CID 114556320) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 114556320 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CCCn1nccc1CN(C)CCN |
| InChI | InChI=1S/C10H20N4/c1-3-7-14-10(4-6-12-14)9-13(2)8-5-11/h4,6H,3,5,7-9,11H2,1-2H3 |
| InChIKey | KDQSYTSGYMGRRP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine (CID 114556320) is N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine is CCCn1nccc1CN(C)CCN.
What is the InChIKey of N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine?
The InChIKey is KDQSYTSGYMGRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-3-7-14-10(4-6-12-14)9-13(2)8-5-11/h4,6H,3,5,7-9,11H2,1-2H3.
What are the key properties of N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine?
N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine has a molecular weight of 196.30 g/mol, XLogP of 0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[(2-propylpyrazol-3-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 114556320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).