C34H39N3O4 — CID 11455686
5-[2-[(2R)-2-azidopropyl]-4,6-di(propan-2-yloxy)phenyl]-1-methoxy-3-methyl-8-phenylmethoxynaphthalene (PubChem CID 11455686) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is 5-[2-[(2R)-2-azidopropyl]-4,6-di(propan-2-yloxy)phenyl]-1-methoxy-3-methyl-8-phenylmethoxynaphthalene.
| Compound Name | 5-[2-[(2R)-2-azidopropyl]-4,6-di(propan-2-yloxy)phenyl]-1-methoxy-3-methyl-8-phenylmethoxynaphthalene |
|---|---|
| PubChem CID | 11455686 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 5-[2-[(2R)-2-azidopropyl]-4,6-di(propan-2-yloxy)phenyl]-1-methoxy-3-methyl-8-phenylmethoxynaphthalene |
| SMILES | COc1cc(C)cc2c(-c3c(C[C@@H](C)N=[N+]=[N-])cc(OC(C)C)cc3OC(C)C)ccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C34H39N3O4/c1-21(2)40-27-18-26(17-24(6)36-37-35)33(32(19-27)41-22(3)4)28-13-14-30(39-20-25-11-9-8-10-12-25)34-29(28)15-23(5)16-31(34)38-7/h8-16,18-19,21-22,24H,17,20H2,1-7H3/t24-/m1/s1 |
| InChIKey | ZRNKVRXRLCTOFR-XMMPIXPASA-N |
| XLogP | 9.22 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|