C13H19N5 — CID 114557312
6-tert-butyl-2-(2-ethylpyrazol-3-yl)pyrimidin-4-amine (PubChem CID 114557312) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-tert-butyl-2-(2-ethylpyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(2-ethylpyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114557312 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 6-tert-butyl-2-(2-ethylpyrazol-3-yl)pyrimidin-4-amine |
| SMILES | CCn1nccc1-c1nc(N)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H19N5/c1-5-18-9(6-7-15-18)12-16-10(13(2,3)4)8-11(14)17-12/h6-8H,5H2,1-4H3,(H2,14,16,17) |
| InChIKey | FMQPMLQMQLENJZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |