C26H43NO10S — CID 11455787
[(1S,2R,3R,4R,5S,6S,8R,9R,13R,14R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate (PubChem CID 11455787) has the molecular formula C26H43NO10S and a molecular weight of 561.69 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5S,6S,8R,9R,13R,14R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate.
| Compound Name | [(1S,2R,3R,4R,5S,6S,8R,9R,13R,14R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 11455787 |
| Molecular Formula | C26H43NO10S |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | [(1S,2R,3R,4R,5S,6S,8R,9R,13R,14R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate |
| SMILES | CCN1C[C@]2(COC)[C@H](O)C[C@H](OC)[C@]34C1[C@H]([C@H](OC)[C@H]23)[C@@]1(O)C[C@H](OC)[C@@]2(O)C[C@@H]4[C@@H]1[C@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C26H43NO10S/c1-7-27-11-23(12-33-2)14(28)8-15(34-3)26-13-9-24(29)16(35-4)10-25(30,17(13)22(24)37-38(6,31)32)18(21(26)27)19(36-5)20(23)26/h13-22,28-30H,7-12H2,1-6H3/t13-,14-,15+,16+,17-,18+,19+,20-,21?,22-,23+,24+,25-,26+/m1/s1 |
| InChIKey | IPFDEDBHIOEYLX-WCWAXHELSA-N |
| XLogP | -0.77 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|