C10H16N2O — CID 114558305
[2-(2-propylpyrazol-3-yl)cyclopropyl]methanol (PubChem CID 114558305) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is [2-(2-propylpyrazol-3-yl)cyclopropyl]methanol.
| Compound Name | [2-(2-propylpyrazol-3-yl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 114558305 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | [2-(2-propylpyrazol-3-yl)cyclopropyl]methanol |
| SMILES | CCCn1nccc1C1CC1CO |
| InChI | InChI=1S/C10H16N2O/c1-2-5-12-10(3-4-11-12)9-6-8(9)7-13/h3-4,8-9,13H,2,5-7H2,1H3 |
| InChIKey | OOEGJOBRHPDXQF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |