C10H14N4S — CID 114558342
N-ethyl-5-(2-ethylpyrazol-3-yl)-1,3-thiazol-2-amine (PubChem CID 114558342) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is N-ethyl-5-(2-ethylpyrazol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-5-(2-ethylpyrazol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114558342 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | N-ethyl-5-(2-ethylpyrazol-3-yl)-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(-c2ccnn2CC)s1 |
| InChI | InChI=1S/C10H14N4S/c1-3-11-10-12-7-9(15-10)8-5-6-13-14(8)4-2/h5-7H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | HRPLEFLVMNDTFX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |