C13H11Br2ClFNS — CID 114559092
N-[(5-bromo-4-chlorothiophen-2-yl)-(2-bromo-6-fluorophenyl)methyl]ethanamine (PubChem CID 114559092) has the molecular formula C13H11Br2ClFNS and a molecular weight of 427.56 g/mol. Its IUPAC name is N-[(5-bromo-4-chlorothiophen-2-yl)-(2-bromo-6-fluorophenyl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-4-chlorothiophen-2-yl)-(2-bromo-6-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114559092 |
| Molecular Formula | C13H11Br2ClFNS |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 424.87 |
| IUPAC Name | N-[(5-bromo-4-chlorothiophen-2-yl)-(2-bromo-6-fluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)c(Br)s1)c1c(F)cccc1Br |
| InChI | InChI=1S/C13H11Br2ClFNS/c1-2-18-12(10-6-8(16)13(15)19-10)11-7(14)4-3-5-9(11)17/h3-6,12,18H,2H2,1H3 |
| InChIKey | NXHKZBKLLCYBBM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |