C15H15BrFNO3 — CID 114559116
methyl 5-[(2-bromo-6-fluorophenyl)-(ethylamino)methyl]furan-2-carboxylate (PubChem CID 114559116) has the molecular formula C15H15BrFNO3 and a molecular weight of 356.19 g/mol. Its IUPAC name is methyl 5-[(2-bromo-6-fluorophenyl)-(ethylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(2-bromo-6-fluorophenyl)-(ethylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 114559116 |
| Molecular Formula | C15H15BrFNO3 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | methyl 5-[(2-bromo-6-fluorophenyl)-(ethylamino)methyl]furan-2-carboxylate |
| SMILES | CCNC(c1ccc(C(=O)OC)o1)c1c(F)cccc1Br |
| InChI | InChI=1S/C15H15BrFNO3/c1-3-18-14(13-9(16)5-4-6-10(13)17)11-7-8-12(21-11)15(19)20-2/h4-8,14,18H,3H2,1-2H3 |
| InChIKey | KRCICPKSSFUGAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |