C9H8BrFN2OS — CID 114559233
N-(2-amino-2-sulfanylideneethyl)-2-bromo-6-fluorobenzamide (PubChem CID 114559233) has the molecular formula C9H8BrFN2OS and a molecular weight of 291.14 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-2-bromo-6-fluorobenzamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-2-bromo-6-fluorobenzamide |
|---|---|
| PubChem CID | 114559233 |
| Molecular Formula | C9H8BrFN2OS |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-2-bromo-6-fluorobenzamide |
| SMILES | NC(=S)CNC(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C9H8BrFN2OS/c10-5-2-1-3-6(11)8(5)9(14)13-4-7(12)15/h1-3H,4H2,(H2,12,15)(H,13,14) |
| InChIKey | YDIJUTPIWPDFER-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|