C11H5Br4FS — CID 114560719
2,3-dibromo-5-[bromo-(2-bromo-6-fluorophenyl)methyl]thiophene (PubChem CID 114560719) has the molecular formula C11H5Br4FS and a molecular weight of 507.84 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo-(2-bromo-6-fluorophenyl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo-(2-bromo-6-fluorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 114560719 |
| Molecular Formula | C11H5Br4FS |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 503.68 |
| IUPAC Name | 2,3-dibromo-5-[bromo-(2-bromo-6-fluorophenyl)methyl]thiophene |
| SMILES | Fc1cccc(Br)c1C(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H5Br4FS/c12-5-2-1-3-7(16)9(5)10(14)8-4-6(13)11(15)17-8/h1-4,10H |
| InChIKey | UDZGVDCBZNRNEM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|