About 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one
1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one (PubChem CID 114561588) has the molecular formula C10H10BrClN4O
and a molecular weight of 317.57 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one.
Molecular Properties
| Compound Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one |
| PubChem CID | 114561588 |
| Molecular Formula | C10H10BrClN4O |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one |
| SMILES | Cc1nn(C)c(Cn2ccnc(Cl)c2=O)c1Br |
| InChI | InChI=1S/C10H10BrClN4O/c1-6-8(11)7(15(2)14-6)5-16-4-3-13-9(12)10(16)17/h3-4H,5H2,1-2H3 |
| InChIKey | KIZLZCAYMFLVLF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one?
The IUPAC name of 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one (CID 114561588) is 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one.
What is the SMILES notation for 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one?
The canonical SMILES for 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one is Cc1nn(C)c(Cn2ccnc(Cl)c2=O)c1Br.
What is the InChIKey of 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one?
The InChIKey is KIZLZCAYMFLVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClN4O/c1-6-8(11)7(15(2)14-6)5-16-4-3-13-9(12)10(16)17/h3-4H,5H2,1-2H3.
What are the key properties of 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one?
1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one has a molecular weight of 317.57 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-chloropyrazin-2-one is sourced from PubChem (CID 114561588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).