C28H28N6O2S4 — CID 11456252
[4-[(4-ethoxyphenyl)carbamothioylsulfanyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate (PubChem CID 11456252) has the molecular formula C28H28N6O2S4 and a molecular weight of 608.84 g/mol. Its IUPAC name is [4-[(4-ethoxyphenyl)carbamothioylsulfanyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate.
| Compound Name | [4-[(4-ethoxyphenyl)carbamothioylsulfanyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate |
|---|---|
| PubChem CID | 11456252 |
| Molecular Formula | C28H28N6O2S4 |
| Molecular Weight | 608.84 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | [4-[(4-ethoxyphenyl)carbamothioylsulfanyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate |
| SMILES | CCOc1ccc(NC(=S)Sc2nc(Nc3cccc(C)c3)nc(SC(=S)Nc3ccc(OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C28H28N6O2S4/c1-4-35-22-13-9-19(10-14-22)30-27(37)39-25-32-24(29-21-8-6-7-18(3)17-21)33-26(34-25)40-28(38)31-20-11-15-23(16-12-20)36-5-2/h6-17H,4-5H2,1-3H3,(H,30,37)(H,31,38)(H,29,32,33,34) |
| InChIKey | DFLGVVHVIBEDTA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.84 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|