C12H13ClF3N3 — CID 114562672
2-chloro-N-cyclopropyl-N-(cyclopropylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562672) has the molecular formula C12H13ClF3N3 and a molecular weight of 291.70 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-(cyclopropylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-cyclopropyl-N-(cyclopropylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562672 |
| Molecular Formula | C12H13ClF3N3 |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-(cyclopropylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(N(CC2CC2)C2CC2)nc(Cl)n1 |
| InChI | InChI=1S/C12H13ClF3N3/c13-11-17-9(12(14,15)16)5-10(18-11)19(8-3-4-8)6-7-1-2-7/h5,7-8H,1-4,6H2 |
| InChIKey | MQYJAXPYHDKPER-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |