C12H8F3N5 — CID 114563422
5-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]pyridine-3-carbonitrile (PubChem CID 114563422) has the molecular formula C12H8F3N5 and a molecular weight of 279.23 g/mol. Its IUPAC name is 5-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 114563422 |
| Molecular Formula | C12H8F3N5 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]pyridine-3-carbonitrile |
| SMILES | CNc1nc(-c2cncc(C#N)c2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H8F3N5/c1-17-11-19-9(3-10(20-11)12(13,14)15)8-2-7(4-16)5-18-6-8/h2-3,5-6H,1H3,(H,17,19,20) |
| InChIKey | DCHQZDYTNPJXLT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |