C37H28ClN5O3 — CID 11456360
(E)-N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-3-quinolin-8-ylprop-2-enamide (PubChem CID 11456360) has the molecular formula C37H28ClN5O3 and a molecular weight of 626.12 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-3-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-3-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 11456360 |
| Molecular Formula | C37H28ClN5O3 |
| Molecular Weight | 626.12 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-3-quinolin-8-ylprop-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccc4)c(Cl)c3)c2cc1NC(=O)/C=C/c1cccc2cccnc12 |
| InChI | InChI=1S/C37H28ClN5O3/c1-2-45-34-20-31-29(19-32(34)43-35(44)16-13-26-11-6-10-25-12-7-17-40-36(25)26)37(27(21-39)22-41-31)42-28-14-15-33(30(38)18-28)46-23-24-8-4-3-5-9-24/h3-20,22H,2,23H2,1H3,(H,41,42)(H,43,44)/b16-13+ |
| InChIKey | VJBGCGWDTBHXQK-DTQAZKPQSA-N |
| XLogP | 8.68 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.12 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|