C12H18F3N5 — CID 114564188
4-[4-(dimethylamino)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114564188) has the molecular formula C12H18F3N5 and a molecular weight of 289.31 g/mol. Its IUPAC name is 4-[4-(dimethylamino)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-[4-(dimethylamino)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114564188 |
| Molecular Formula | C12H18F3N5 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 4-[4-(dimethylamino)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CN(C)C1CCN(c2cc(C(F)(F)F)nc(N)n2)CC1 |
| InChI | InChI=1S/C12H18F3N5/c1-19(2)8-3-5-20(6-4-8)10-7-9(12(13,14)15)17-11(16)18-10/h7-8H,3-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | JACCWTQBDIOCDB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |