C28H55IO4Si2 — CID 11456434
tert-butyl-[(2S)-1-[(2R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethenyl-2-methoxy-6-prop-2-enyloxan-2-yl]-5-iodopentan-2-yl]oxy-dimethylsilane (PubChem CID 11456434) has the molecular formula C28H55IO4Si2 and a molecular weight of 638.82 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(2R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethenyl-2-methoxy-6-prop-2-enyloxan-2-yl]-5-iodopentan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(2R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethenyl-2-methoxy-6-prop-2-enyloxan-2-yl]-5-iodopentan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11456434 |
| Molecular Formula | C28H55IO4Si2 |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | tert-butyl-[(2S)-1-[(2R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethenyl-2-methoxy-6-prop-2-enyloxan-2-yl]-5-iodopentan-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H]1O[C@@](C[C@H](CCCI)O[Si](C)(C)C(C)(C)C)(OC)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C=C |
| InChI | InChI=1S/C28H55IO4Si2/c1-14-17-24-23(15-2)25(33-35(12,13)27(6,7)8)21-28(30-9,31-24)20-22(18-16-19-29)32-34(10,11)26(3,4)5/h14-15,22-25H,1-2,16-21H2,3-13H3/t22-,23-,24-,25-,28+/m0/s1 |
| InChIKey | MXIKLVZJMQWNAC-TVEWEYLFSA-N |
| XLogP | 8.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|