C10H12F3N5 — CID 114564590
3-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile (PubChem CID 114564590) has the molecular formula C10H12F3N5 and a molecular weight of 259.24 g/mol. Its IUPAC name is 3-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile.
| Compound Name | 3-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 114564590 |
| Molecular Formula | C10H12F3N5 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-[[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN(C)c1cc(C(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C10H12F3N5/c1-6(4-14)5-18(2)8-3-7(10(11,12)13)16-9(15)17-8/h3,6H,5H2,1-2H3,(H2,15,16,17) |
| InChIKey | ZBZZOCCEPJHCDF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |