About 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine
4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 114564751) has the molecular formula C12H17F3N4
and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| PubChem CID | 114564751 |
| Molecular Formula | C12H17F3N4 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CC1(Nc2cc(C(F)(F)F)nc(N)n2)CCCCC1 |
| InChI | InChI=1S/C12H17F3N4/c1-11(5-3-2-4-6-11)19-9-7-8(12(13,14)15)17-10(16)18-9/h7H,2-6H2,1H3,(H3,16,17,18,19) |
| InChIKey | OYMUAXMIFCJSAY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine?
The IUPAC name of 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine (CID 114564751) is 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine is CC1(Nc2cc(C(F)(F)F)nc(N)n2)CCCCC1.
What is the InChIKey of 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine?
The InChIKey is OYMUAXMIFCJSAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N4/c1-11(5-3-2-4-6-11)19-9-7-8(12(13,14)15)17-10(16)18-9/h7H,2-6H2,1H3,(H3,16,17,18,19).
What are the key properties of 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine?
4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine has a molecular weight of 274.29 g/mol, XLogP of 3.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(1-methylcyclohexyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 114564751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).