C13H20F3N5 — CID 114565070
4-(3-ethyl-4-methylpiperazin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114565070) has the molecular formula C13H20F3N5 and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-(3-ethyl-4-methylpiperazin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(3-ethyl-4-methylpiperazin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114565070 |
| Molecular Formula | C13H20F3N5 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-(3-ethyl-4-methylpiperazin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCC1CN(c2cc(C(F)(F)F)nc(NC)n2)CCN1C |
| InChI | InChI=1S/C13H20F3N5/c1-4-9-8-21(6-5-20(9)3)11-7-10(13(14,15)16)18-12(17-2)19-11/h7,9H,4-6,8H2,1-3H3,(H,17,18,19) |
| InChIKey | XSWCUGGERWSMQA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |