C12H16F3N5O — CID 114565081
5-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-2-one (PubChem CID 114565081) has the molecular formula C12H16F3N5O and a molecular weight of 303.29 g/mol. Its IUPAC name is 5-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-2-one.
| Compound Name | 5-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 114565081 |
| Molecular Formula | C12H16F3N5O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-2-one |
| SMILES | CCNc1nc(NC2CCC(=O)NC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3N5O/c1-2-16-11-19-8(12(13,14)15)5-9(20-11)18-7-3-4-10(21)17-6-7/h5,7H,2-4,6H2,1H3,(H,17,21)(H2,16,18,19,20) |
| InChIKey | LRDSLDYKFRNSHH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |