About ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate
ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 1145657) has the molecular formula C18H17N5O3S
and a molecular weight of 383.43 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
| PubChem CID | 1145657 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nncn2-c2cccnc2)cc1 |
| InChI | InChI=1S/C18H17N5O3S/c1-2-26-17(25)13-5-7-14(8-6-13)21-16(24)11-27-18-22-20-12-23(18)15-4-3-9-19-10-15/h3-10,12H,2,11H2,1H3,(H,21,24) |
| InChIKey | TWWPSELHVMFBRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate?
The IUPAC name of ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate (CID 1145657) is ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate?
The canonical SMILES for ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate is CCOC(=O)c1ccc(NC(=O)CSc2nncn2-c2cccnc2)cc1.
What is the InChIKey of ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate?
The InChIKey is TWWPSELHVMFBRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O3S/c1-2-26-17(25)13-5-7-14(8-6-13)21-16(24)11-27-18-22-20-12-23(18)15-4-3-9-19-10-15/h3-10,12H,2,11H2,1H3,(H,21,24).
What are the key properties of ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate?
ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate has a molecular weight of 383.43 g/mol, XLogP of 2.57, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2-[(4-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate is sourced from PubChem (CID 1145657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).