C40H43O5PS — CID 11456591
[(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 11456591) has the molecular formula C40H43O5PS and a molecular weight of 666.82 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate.
| Compound Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 11456591 |
| Molecular Formula | C40H43O5PS |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | CCCC(=O)C(C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)C2(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H43O5PS/c1-4-17-35(41)37(46(31-18-9-5-10-19-31,32-20-11-6-12-21-32)33-22-13-7-14-23-33)38(42)45-36-28-30-26-27-40(36,39(30,2)3)29-47(43,44)34-24-15-8-16-25-34/h5-16,18-25,30,36H,4,17,26-29H2,1-3H3/t30-,36-,40-/m1/s1 |
| InChIKey | SFUIWUNWUIPZET-WBTOHBPYSA-N |
| XLogP | 6.73 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|