C12H19F3N4O — CID 114565964
3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol (PubChem CID 114565964) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol.
| Compound Name | 3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 114565964 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol |
| SMILES | CCNc1nc(NC(C)(C)C(C)O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H19F3N4O/c1-5-16-10-17-8(12(13,14)15)6-9(18-10)19-11(3,4)7(2)20/h6-7,20H,5H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | VPEHCAVWLHPFNH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |