C16H16O3 — CID 11456644
(4aS,9aR)-5-hydroxy-2,9a-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione (PubChem CID 11456644) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (4aS,9aR)-5-hydroxy-2,9a-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione.
| Compound Name | (4aS,9aR)-5-hydroxy-2,9a-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione |
|---|---|
| PubChem CID | 11456644 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (4aS,9aR)-5-hydroxy-2,9a-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione |
| SMILES | CC1=CC[C@@H]2C(=O)c3c(O)cccc3C(=O)[C@]2(C)C1 |
| InChI | InChI=1S/C16H16O3/c1-9-6-7-11-14(18)13-10(4-3-5-12(13)17)15(19)16(11,2)8-9/h3-6,11,17H,7-8H2,1-2H3/t11-,16-/m1/s1 |
| InChIKey | YWBIICCWFQLOJH-BDJLRTHQSA-N |
| XLogP | 3.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|