About 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine
4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566585) has the molecular formula C9H9F6N3O
and a molecular weight of 289.18 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 114566585 |
| Molecular Formula | C9H9F6N3O |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1nc(OCCCC(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F6N3O/c10-8(11,12)2-1-3-19-6-4-5(9(13,14)15)17-7(16)18-6/h4H,1-3H2,(H2,16,17,18) |
| InChIKey | JSWKSPMPGXNLBD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine (CID 114566585) is 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine is Nc1nc(OCCCC(F)(F)F)cc(C(F)(F)F)n1.
What is the InChIKey of 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is JSWKSPMPGXNLBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F6N3O/c10-8(11,12)2-1-3-19-6-4-5(9(13,14)15)17-7(16)18-6/h4H,1-3H2,(H2,16,17,18).
What are the key properties of 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine?
4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 289.18 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4,4-trifluorobutoxy)-6-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 114566585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).