C32H70O7Si4 — CID 11456667
2-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxyoxolan-2-yl]acetaldehyde (PubChem CID 11456667) has the molecular formula C32H70O7Si4 and a molecular weight of 679.25 g/mol. Its IUPAC name is 2-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxyoxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxyoxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11456667 |
| Molecular Formula | C32H70O7Si4 |
| Molecular Weight | 679.25 g/mol |
| Exact Mass | 678.42 |
| IUPAC Name | 2-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxyoxolan-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(O)(CC=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H70O7Si4/c1-28(2,3)40(13,14)35-23-24(37-41(15,16)29(4,5)6)25-26(38-42(17,18)30(7,8)9)27(32(34,36-25)21-22-33)39-43(19,20)31(10,11)12/h22,24-27,34H,21,23H2,1-20H3/t24-,25-,26+,27-,32?/m1/s1 |
| InChIKey | PEYQOALFFRTTEH-PZFLESAZSA-N |
| XLogP | 8.86 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.25 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|