C9H12N4O2 — CID 114568646
3-[(2-oxopiperidin-3-yl)amino]-1H-pyrazin-2-one (PubChem CID 114568646) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-[(2-oxopiperidin-3-yl)amino]-1H-pyrazin-2-one.
| Compound Name | 3-[(2-oxopiperidin-3-yl)amino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 114568646 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-[(2-oxopiperidin-3-yl)amino]-1H-pyrazin-2-one |
| SMILES | O=C1NCCCC1Nc1ncc[nH]c1=O |
| InChI | InChI=1S/C9H12N4O2/c14-8-6(2-1-3-11-8)13-7-9(15)12-5-4-10-7/h4-6H,1-3H2,(H,10,13)(H,11,14)(H,12,15) |
| InChIKey | VPGMTTBBGYQFQF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |