C33H39F3N4O8S2 — CID 11456906
methyl (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoate (PubChem CID 11456906) has the molecular formula C33H39F3N4O8S2 and a molecular weight of 740.82 g/mol. Its IUPAC name is methyl (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoate.
| Compound Name | methyl (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 11456906 |
| Molecular Formula | C33H39F3N4O8S2 |
| Molecular Weight | 740.82 g/mol |
| Exact Mass | 740.22 |
| IUPAC Name | methyl (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoate |
| SMILES | COC(=O)[C@@H](CCC/N=C(\N)NS(=O)(=O)c1c(C)c(C)c2c(c1C)CCC(C)(C)O2)NS(=O)(=O)c1cc(F)c(Oc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C33H39F3N4O8S2/c1-18-19(2)30(20(3)24-13-14-33(4,5)48-28(18)24)50(44,45)40-32(37)38-15-7-8-27(31(41)46-6)39-49(42,43)23-16-25(35)29(26(36)17-23)47-22-11-9-21(34)10-12-22/h9-12,16-17,27,39H,7-8,13-15H2,1-6H3,(H3,37,38,40)/t27-/m1/s1 |
| InChIKey | FVXCDPKPBVEGNW-HHHXNRCGSA-N |
| XLogP | 4.82 |
| TPSA | 175.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.82 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|