C12H20N4O — CID 114570393
3-[2-[1-(methylamino)ethyl]piperidin-1-yl]-1H-pyrazin-2-one (PubChem CID 114570393) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-[2-[1-(methylamino)ethyl]piperidin-1-yl]-1H-pyrazin-2-one.
| Compound Name | 3-[2-[1-(methylamino)ethyl]piperidin-1-yl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 114570393 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[2-[1-(methylamino)ethyl]piperidin-1-yl]-1H-pyrazin-2-one |
| SMILES | CNC(C)C1CCCCN1c1ncc[nH]c1=O |
| InChI | InChI=1S/C12H20N4O/c1-9(13-2)10-5-3-4-8-16(10)11-12(17)15-7-6-14-11/h6-7,9-10,13H,3-5,8H2,1-2H3,(H,15,17) |
| InChIKey | MDMRMOWZLAKOJX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |