C13H13N3O3 — CID 114570497
2-[2-[(2-oxo-1H-pyrazin-3-yl)amino]ethyl]benzoic acid (PubChem CID 114570497) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[2-[(2-oxo-1H-pyrazin-3-yl)amino]ethyl]benzoic acid.
| Compound Name | 2-[2-[(2-oxo-1H-pyrazin-3-yl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 114570497 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[2-[(2-oxo-1H-pyrazin-3-yl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCNc1ncc[nH]c1=O |
| InChI | InChI=1S/C13H13N3O3/c17-12-11(15-7-8-16-12)14-6-5-9-3-1-2-4-10(9)13(18)19/h1-4,7-8H,5-6H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | XZXKNXMPKXDHDI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |