C8H11N3O4 — CID 114571199
methyl 3-hydroxy-2-[(2-oxo-1H-pyrazin-3-yl)amino]propanoate (PubChem CID 114571199) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(2-oxo-1H-pyrazin-3-yl)amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[(2-oxo-1H-pyrazin-3-yl)amino]propanoate |
|---|---|
| PubChem CID | 114571199 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | methyl 3-hydroxy-2-[(2-oxo-1H-pyrazin-3-yl)amino]propanoate |
| SMILES | COC(=O)C(CO)Nc1ncc[nH]c1=O |
| InChI | InChI=1S/C8H11N3O4/c1-15-8(14)5(4-12)11-6-7(13)10-3-2-9-6/h2-3,5,12H,4H2,1H3,(H,9,11)(H,10,13) |
| InChIKey | AZXBVCNIPHHATP-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |