C9H10N2O3S — CID 114573961
2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetic acid (PubChem CID 114573961) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 114573961 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C9H10N2O3S/c12-6-3-7(15-4-8(13)14)11-9(10-6)5-1-2-5/h3,5H,1-2,4H2,(H,13,14)(H,10,11,12) |
| InChIKey | UAADBOUUOMYBPF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |