C10H11ClN2O3S — CID 114574072
2-[1-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 114574072) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 2-[1-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 114574072 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[1-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSc2nc[nH]c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C10H11ClN2O3S/c11-7-8(16)12-5-13-9(7)17-4-10(1-2-10)3-6(14)15/h5H,1-4H2,(H,14,15)(H,12,13,16) |
| InChIKey | RYDZJLSDYOGMEK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |