C11H14N2O3S — CID 114574096
3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoic acid (PubChem CID 114574096) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoic acid.
| Compound Name | 3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 114574096 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoic acid |
| SMILES | CC(CC(=O)O)Sc1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C11H14N2O3S/c1-6(4-10(15)16)17-9-5-8(14)12-11(13-9)7-2-3-7/h5-7H,2-4H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | GOSBPLUMMCULKA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |