C9H11ClN2O3S — CID 114574114
methyl 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-2-methylpropanoate (PubChem CID 114574114) has the molecular formula C9H11ClN2O3S and a molecular weight of 262.72 g/mol. Its IUPAC name is methyl 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-2-methylpropanoate.
| Compound Name | methyl 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 114574114 |
| Molecular Formula | C9H11ClN2O3S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | methyl 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CSc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C9H11ClN2O3S/c1-5(9(14)15-2)3-16-8-6(10)7(13)11-4-12-8/h4-5H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | RSCAVCKEDWMQEC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |