C9H5ClN2O3S2 — CID 114574122
4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]thiophene-2-carboxylic acid (PubChem CID 114574122) has the molecular formula C9H5ClN2O3S2 and a molecular weight of 288.74 g/mol. Its IUPAC name is 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114574122 |
| Molecular Formula | C9H5ClN2O3S2 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)sulfanyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Sc2nc[nH]c(=O)c2Cl)cs1 |
| InChI | InChI=1S/C9H5ClN2O3S2/c10-6-7(13)11-3-12-8(6)17-4-1-5(9(14)15)16-2-4/h1-3H,(H,14,15)(H,11,12,13) |
| InChIKey | UCVNRTYDECWJOK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |