C9H10FN — CID 11457782
cis-(1R,2S)-2-fluoro-1-phenylcyclopropan-1-amine (PubChem CID 11457782) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is cis-(1R,2S)-2-fluoro-1-phenylcyclopropan-1-amine.
| Compound Name | cis-(1R,2S)-2-fluoro-1-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 11457782 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | cis-(1R,2S)-2-fluoro-1-phenylcyclopropan-1-amine |
| SMILES | N[C@@]1(c2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C9H10FN/c10-8-6-9(8,11)7-4-2-1-3-5-7/h1-5,8H,6,11H2/t8-,9+/m0/s1 |
| InChIKey | ORKWDOXDSJHZAW-DTWKUNHWSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |