C13H15N3O2 — CID 114578659
4-(5-amino-2-methylphenoxy)-2-ethyl-1H-pyrimidin-6-one (PubChem CID 114578659) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(5-amino-2-methylphenoxy)-2-ethyl-1H-pyrimidin-6-one.
| Compound Name | 4-(5-amino-2-methylphenoxy)-2-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578659 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-(5-amino-2-methylphenoxy)-2-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(Oc2cc(N)ccc2C)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H15N3O2/c1-3-11-15-12(17)7-13(16-11)18-10-6-9(14)5-4-8(10)2/h4-7H,3,14H2,1-2H3,(H,15,16,17) |
| InChIKey | MTPNTPYXFPSHIT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|