C6H7BrN2O2S — CID 114578900
5-bromo-4-(2-hydroxyethylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 114578900) has the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. Its IUPAC name is 5-bromo-4-(2-hydroxyethylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(2-hydroxyethylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578900 |
| Molecular Formula | C6H7BrN2O2S |
| Molecular Weight | 251.10 g/mol |
| Exact Mass | 249.94 |
| IUPAC Name | 5-bromo-4-(2-hydroxyethylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(SCCO)c1Br |
| InChI | InChI=1S/C6H7BrN2O2S/c7-4-5(11)8-3-9-6(4)12-2-1-10/h3,10H,1-2H2,(H,8,9,11) |
| InChIKey | NIDOGRRLLYOSAO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |