C7H10N2O2S — CID 114578908
4-(2-hydroxyethylsulfanyl)-2-methyl-1H-pyrimidin-6-one (PubChem CID 114578908) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfanyl)-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2-hydroxyethylsulfanyl)-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578908 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 4-(2-hydroxyethylsulfanyl)-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(SCCO)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5-8-6(11)4-7(9-5)12-3-2-10/h4,10H,2-3H2,1H3,(H,8,9,11) |
| InChIKey | APJDGOZBZPYJOV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |