C9H14N2O2S — CID 114578928
4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-1H-pyrimidin-6-one (PubChem CID 114578928) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578928 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(SC(C)CCO)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O2S/c1-6(3-4-12)14-9-5-8(13)10-7(2)11-9/h5-6,12H,3-4H2,1-2H3,(H,10,11,13) |
| InChIKey | KJDJDZQHJVMIAK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |