C15H12N2O3 — CID 114580959
4-(3-hydroxynaphthalen-2-yl)oxy-2-methyl-1H-pyrimidin-6-one (PubChem CID 114580959) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4-(3-hydroxynaphthalen-2-yl)oxy-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(3-hydroxynaphthalen-2-yl)oxy-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114580959 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-(3-hydroxynaphthalen-2-yl)oxy-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(Oc2cc3ccccc3cc2O)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H12N2O3/c1-9-16-14(19)8-15(17-9)20-13-7-11-5-3-2-4-10(11)6-12(13)18/h2-8,18H,1H3,(H,16,17,19) |
| InChIKey | ZLIBUCMSUSRZMX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |