About 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole
1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole (PubChem CID 11458123) has the molecular formula C10H19FN2
and a molecular weight of 186.27 g/mol. Its IUPAC name is 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole |
| PubChem CID | 11458123 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole |
| SMILES | CC1=NCCN1CCCCCCF |
| InChI | InChI=1S/C10H19FN2/c1-10-12-7-9-13(10)8-5-3-2-4-6-11/h2-9H2,1H3 |
| InChIKey | UZMNDZNUCIMTRL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole?
The IUPAC name of 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole (CID 11458123) is 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole.
What is the SMILES notation for 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole?
The canonical SMILES for 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole is CC1=NCCN1CCCCCCF.
What is the InChIKey of 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole?
The InChIKey is UZMNDZNUCIMTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FN2/c1-10-12-7-9-13(10)8-5-3-2-4-6-11/h2-9H2,1H3.
What are the key properties of 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole?
1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole has a molecular weight of 186.27 g/mol, XLogP of 2.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluorohexyl)-2-methyl-4,5-dihydroimidazole is sourced from PubChem (CID 11458123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).