About 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one
6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one (PubChem CID 114581594) has the molecular formula C12H17ClN2O2
and a molecular weight of 256.73 g/mol. Its IUPAC name is 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one |
| PubChem CID | 114581594 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one |
| SMILES | Cc1nc(Cl)cc(=O)n1CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-8-14-10(13)6-11(16)15(8)7-9-4-5-12(2,3)17-9/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | CDAXDQYEDJHPPS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one?
The IUPAC name of 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one (CID 114581594) is 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one.
What is the SMILES notation for 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one?
The canonical SMILES for 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one is Cc1nc(Cl)cc(=O)n1CC1CCC(C)(C)O1.
What is the InChIKey of 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one?
The InChIKey is CDAXDQYEDJHPPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2O2/c1-8-14-10(13)6-11(16)15(8)7-9-4-5-12(2,3)17-9/h6,9H,4-5,7H2,1-3H3.
What are the key properties of 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one?
6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one has a molecular weight of 256.73 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylpyrimidin-4-one is sourced from PubChem (CID 114581594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).