C8H10ClN3O2 — CID 114581614
2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-N-methylacetamide (PubChem CID 114581614) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-N-methylacetamide.
| Compound Name | 2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 114581614 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(C)nc(Cl)cc1=O |
| InChI | InChI=1S/C8H10ClN3O2/c1-5-11-6(9)3-8(14)12(5)4-7(13)10-2/h3H,4H2,1-2H3,(H,10,13) |
| InChIKey | IBIOIFVXBVHCEL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |