C12H18ClN3O2 — CID 114581719
N-butyl-2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)propanamide (PubChem CID 114581719) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is N-butyl-2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)propanamide.
| Compound Name | N-butyl-2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)propanamide |
|---|---|
| PubChem CID | 114581719 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-butyl-2-(4-chloro-2-methyl-6-oxopyrimidin-1-yl)propanamide |
| SMILES | CCCCNC(=O)C(C)n1c(C)nc(Cl)cc1=O |
| InChI | InChI=1S/C12H18ClN3O2/c1-4-5-6-14-12(18)8(2)16-9(3)15-10(13)7-11(16)17/h7-8H,4-6H2,1-3H3,(H,14,18) |
| InChIKey | FMRWMBIUDWRMCX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|