C7H7ClF2N2O — CID 114581781
6-chloro-3-(2,2-difluoroethyl)-2-methylpyrimidin-4-one (PubChem CID 114581781) has the molecular formula C7H7ClF2N2O and a molecular weight of 208.59 g/mol. Its IUPAC name is 6-chloro-3-(2,2-difluoroethyl)-2-methylpyrimidin-4-one.
| Compound Name | 6-chloro-3-(2,2-difluoroethyl)-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 114581781 |
| Molecular Formula | C7H7ClF2N2O |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 6-chloro-3-(2,2-difluoroethyl)-2-methylpyrimidin-4-one |
| SMILES | Cc1nc(Cl)cc(=O)n1CC(F)F |
| InChI | InChI=1S/C7H7ClF2N2O/c1-4-11-5(8)2-7(13)12(4)3-6(9)10/h2,6H,3H2,1H3 |
| InChIKey | BRQXNNNPHJDOEC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |